C23H26N6O4 — CID 122333532
2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 122333532) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122333532 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2CCOCC2)nc(N2CCN(C(=O)CN3C(=O)c4ccccc4C3=O)CC2)n1 |
| InChI | InChI=1S/C23H26N6O4/c1-16-14-19(26-10-12-33-13-11-26)25-23(24-16)28-8-6-27(7-9-28)20(30)15-29-21(31)17-4-2-3-5-18(17)22(29)32/h2-5,14H,6-13,15H2,1H3 |
| InChIKey | KAHGMCGDQJRCGP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|