C26H26N6O4 — CID 122346610
2-[2-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 122346610) has the molecular formula C26H26N6O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is 2-[2-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122346610 |
| Molecular Formula | C26H26N6O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-[2-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | COc1ccc(Nc2cc(C)nc(N3CCN(C(=O)CN4C(=O)c5ccccc5C4=O)CC3)n2)cc1 |
| InChI | InChI=1S/C26H26N6O4/c1-17-15-22(28-18-7-9-19(36-2)10-8-18)29-26(27-17)31-13-11-30(12-14-31)23(33)16-32-24(34)20-5-3-4-6-21(20)25(32)35/h3-10,15H,11-14,16H2,1-2H3,(H,27,28,29) |
| InChIKey | WAFAJLKZRUFYIH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|