C21H26N6O3 — CID 121032103
5-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 121032103) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 5-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 5-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 121032103 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-[4-[4-(4-methoxyanilino)-6-methylpyrimidin-2-yl]piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccc(Nc2cc(C)nc(N3CCN(C(=O)C4CCC(=O)N4)CC3)n2)cc1 |
| InChI | InChI=1S/C21H26N6O3/c1-14-13-18(23-15-3-5-16(30-2)6-4-15)25-21(22-14)27-11-9-26(10-12-27)20(29)17-7-8-19(28)24-17/h3-6,13,17H,7-12H2,1-2H3,(H,24,28)(H,22,23,25) |
| InChIKey | JZTQGNYDUKRZOV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |