C23H28N6O3 — CID 163349554
2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 163349554) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163349554 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 2-[2-[4-(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)piperazin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2CCOCC2)nc(N2CCN(CCN3C(=O)c4ccccc4C3=O)CC2)n1 |
| InChI | InChI=1S/C23H28N6O3/c1-17-16-20(27-12-14-32-15-13-27)25-23(24-17)28-9-6-26(7-10-28)8-11-29-21(30)18-4-2-3-5-19(18)22(29)31/h2-5,16H,6-15H2,1H3 |
| InChIKey | YRDZEHXRNXWGIN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|