C20H28N6O — CID 171326637
4-[4-methyl-6-[4-(2-pyridin-2-ylethyl)piperazin-1-yl]pyrimidin-2-yl]morpholine (PubChem CID 171326637) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 4-[4-methyl-6-[4-(2-pyridin-2-ylethyl)piperazin-1-yl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-methyl-6-[4-(2-pyridin-2-ylethyl)piperazin-1-yl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 171326637 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-[4-methyl-6-[4-(2-pyridin-2-ylethyl)piperazin-1-yl]pyrimidin-2-yl]morpholine |
| SMILES | Cc1cc(N2CCN(CCc3ccccn3)CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H28N6O/c1-17-16-19(23-20(22-17)26-12-14-27-15-13-26)25-10-8-24(9-11-25)7-5-18-4-2-3-6-21-18/h2-4,6,16H,5,7-15H2,1H3 |
| InChIKey | NWZUTYDYQQLLMV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 57.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |