C18H28N8O — CID 171333986
4-[4-methyl-6-[4-[2-(1-methyltriazol-4-yl)ethyl]piperazin-1-yl]pyrimidin-2-yl]morpholine (PubChem CID 171333986) has the molecular formula C18H28N8O and a molecular weight of 372.48 g/mol. Its IUPAC name is 4-[4-methyl-6-[4-[2-(1-methyltriazol-4-yl)ethyl]piperazin-1-yl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-methyl-6-[4-[2-(1-methyltriazol-4-yl)ethyl]piperazin-1-yl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 171333986 |
| Molecular Formula | C18H28N8O |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 4-[4-methyl-6-[4-[2-(1-methyltriazol-4-yl)ethyl]piperazin-1-yl]pyrimidin-2-yl]morpholine |
| SMILES | Cc1cc(N2CCN(CCc3cn(C)nn3)CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H28N8O/c1-15-13-17(20-18(19-15)26-9-11-27-12-10-26)25-7-5-24(6-8-25)4-3-16-14-23(2)22-21-16/h13-14H,3-12H2,1-2H3 |
| InChIKey | HWSMVEVFTOSKPY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 75.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |