C15H25N5O3S — CID 27656202
4-[2-(4-ethylsulfonylpiperazin-1-yl)-6-methylpyrimidin-4-yl]morpholine (PubChem CID 27656202) has the molecular formula C15H25N5O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 4-[2-(4-ethylsulfonylpiperazin-1-yl)-6-methylpyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-(4-ethylsulfonylpiperazin-1-yl)-6-methylpyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 27656202 |
| Molecular Formula | C15H25N5O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-[2-(4-ethylsulfonylpiperazin-1-yl)-6-methylpyrimidin-4-yl]morpholine |
| SMILES | CCS(=O)(=O)N1CCN(c2nc(C)cc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C15H25N5O3S/c1-3-24(21,22)20-6-4-19(5-7-20)15-16-13(2)12-14(17-15)18-8-10-23-11-9-18/h12H,3-11H2,1-2H3 |
| InChIKey | KJRZJKJXNIIYAS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |