C19H24FN5O3S — CID 50947561
4-[4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-yl]morpholine (PubChem CID 50947561) has the molecular formula C19H24FN5O3S and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-yl]morpholine.
| Compound Name | 4-[4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 50947561 |
| Molecular Formula | C19H24FN5O3S |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-[4-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-2-yl]morpholine |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H24FN5O3S/c1-15-13-18(22-19(21-15)24-9-11-28-12-10-24)23-5-7-25(8-6-23)29(26,27)17-4-2-3-16(20)14-17/h2-4,13-14H,5-12H2,1H3 |
| InChIKey | CKMGDNPFQFNNFH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |