C17H30N6O2S — CID 27637479
4-methyl-6-(4-methylpiperazin-1-yl)-2-(4-propylsulfonylpiperazin-1-yl)pyrimidine (PubChem CID 27637479) has the molecular formula C17H30N6O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-methyl-6-(4-methylpiperazin-1-yl)-2-(4-propylsulfonylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-methyl-6-(4-methylpiperazin-1-yl)-2-(4-propylsulfonylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 27637479 |
| Molecular Formula | C17H30N6O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 4-methyl-6-(4-methylpiperazin-1-yl)-2-(4-propylsulfonylpiperazin-1-yl)pyrimidine |
| SMILES | CCCS(=O)(=O)N1CCN(c2nc(C)cc(N3CCN(C)CC3)n2)CC1 |
| InChI | InChI=1S/C17H30N6O2S/c1-4-13-26(24,25)23-11-9-22(10-12-23)17-18-15(2)14-16(19-17)21-7-5-20(3)6-8-21/h14H,4-13H2,1-3H3 |
| InChIKey | UKYAINBOUHJXRS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |