C19H27N5O3S2 — CID 122333647
4-[2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-4-yl]morpholine (PubChem CID 122333647) has the molecular formula C19H27N5O3S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 4-[2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 122333647 |
| Molecular Formula | C19H27N5O3S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-[2-[4-(5-ethylthiophen-2-yl)sulfonylpiperazin-1-yl]-6-methylpyrimidin-4-yl]morpholine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCN(c3nc(C)cc(N4CCOCC4)n3)CC2)s1 |
| InChI | InChI=1S/C19H27N5O3S2/c1-3-16-4-5-18(28-16)29(25,26)24-8-6-23(7-9-24)19-20-15(2)14-17(21-19)22-10-12-27-13-11-22/h4-5,14H,3,6-13H2,1-2H3 |
| InChIKey | KMTASZALULZIDV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |