C32H36N4O10 — CID 2829028
2-[2-[16-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 2829028) has the molecular formula C32H36N4O10 and a molecular weight of 636.66 g/mol. Its IUPAC name is 2-[2-[16-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[16-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2829028 |
| Molecular Formula | C32H36N4O10 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 2-[2-[16-[2-(1,3-dioxoisoindol-2-yl)acetyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)N1CCOCCOCCN(C(=O)CN2C(=O)c3ccccc3C2=O)CCOCCOCC1 |
| InChI | InChI=1S/C32H36N4O10/c37-27(21-35-29(39)23-5-1-2-6-24(23)30(35)40)33-9-13-43-17-19-45-15-11-34(12-16-46-20-18-44-14-10-33)28(38)22-36-31(41)25-7-3-4-8-26(25)32(36)42/h1-8H,9-22H2 |
| InChIKey | SOHVBHXZAGQMRX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 152.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|