C16H16N2O6 — CID 119251406
1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 119251406) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119251406 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)acetyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C16H16N2O6/c19-12(17-7-5-16(24,6-8-17)15(22)23)9-18-13(20)10-3-1-2-4-11(10)14(18)21/h1-4,24H,5-9H2,(H,22,23) |
| InChIKey | YAPPGHMYESIKPG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|