C20H19F3N6O2 — CID 122345938
[4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone (PubChem CID 122345938) has the molecular formula C20H19F3N6O2 and a molecular weight of 432.41 g/mol. Its IUPAC name is [4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone.
| Compound Name | [4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 122345938 |
| Molecular Formula | C20H19F3N6O2 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazin-1-yl]-(2,4,5-trifluoro-3-methoxyphenyl)methanone |
| SMILES | COc1c(F)c(F)cc(C(=O)N2CCN(c3ccc(-n4ccc(C)n4)nn3)CC2)c1F |
| InChI | InChI=1S/C20H19F3N6O2/c1-12-5-6-29(26-12)16-4-3-15(24-25-16)27-7-9-28(10-8-27)20(30)13-11-14(21)18(23)19(31-2)17(13)22/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | OVONZCYYLYGCHN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|