C19H20FN7O — CID 56920257
N-(2-fluorophenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide (PubChem CID 56920257) has the molecular formula C19H20FN7O and a molecular weight of 381.42 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56920257 |
| Molecular Formula | C19H20FN7O |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(2-fluorophenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide |
| SMILES | Cc1ccn(-c2ccc(N3CCN(C(=O)Nc4ccccc4F)CC3)nn2)n1 |
| InChI | InChI=1S/C19H20FN7O/c1-14-8-9-27(24-14)18-7-6-17(22-23-18)25-10-12-26(13-11-25)19(28)21-16-5-3-2-4-15(16)20/h2-9H,10-13H2,1H3,(H,21,28) |
| InChIKey | LEOIBLNSOHFBOZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |