C21H25N7O — CID 56921616
N-(4-ethylphenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide (PubChem CID 56921616) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56921616 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-(4-ethylphenyl)-4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]piperazine-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)N2CCN(c3ccc(-n4ccc(C)n4)nn3)CC2)cc1 |
| InChI | InChI=1S/C21H25N7O/c1-3-17-4-6-18(7-5-17)22-21(29)27-14-12-26(13-15-27)19-8-9-20(24-23-19)28-11-10-16(2)25-28/h4-11H,3,12-15H2,1-2H3,(H,22,29) |
| InChIKey | HPJQGTMRJRIDJF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |