C17H19N7OS — CID 122346068
4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 122346068) has the molecular formula C17H19N7OS and a molecular weight of 369.45 g/mol. Its IUPAC name is 4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122346068 |
| Molecular Formula | C17H19N7OS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | Cc1ccn(-c2ccc(N3CCN(C(=O)Nc4cccs4)CC3)nn2)n1 |
| InChI | InChI=1S/C17H19N7OS/c1-13-6-7-24(21-13)15-5-4-14(19-20-15)22-8-10-23(11-9-22)17(25)18-16-3-2-12-26-16/h2-7,12H,8-11H2,1H3,(H,18,25) |
| InChIKey | DDFBJWMFIVYRIB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |