C17H22N6OS — CID 122343979
4-(2-pyrrolidin-1-ylpyrimidin-4-yl)-N-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 122343979) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-(2-pyrrolidin-1-ylpyrimidin-4-yl)-N-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-(2-pyrrolidin-1-ylpyrimidin-4-yl)-N-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122343979 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-(2-pyrrolidin-1-ylpyrimidin-4-yl)-N-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccs1)N1CCN(c2ccnc(N3CCCC3)n2)CC1 |
| InChI | InChI=1S/C17H22N6OS/c24-17(20-15-4-3-13-25-15)23-11-9-21(10-12-23)14-5-6-18-16(19-14)22-7-1-2-8-22/h3-6,13H,1-2,7-12H2,(H,20,24) |
| InChIKey | UIRHHPBGYNHCNN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |