C19H26N6OS — CID 122335991
4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 122335991) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is 4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122335991 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]-N-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | CC1CCCCN1c1ccc(N2CCN(C(=O)Nc3cccs3)CC2)nn1 |
| InChI | InChI=1S/C19H26N6OS/c1-15-5-2-3-9-25(15)17-8-7-16(21-22-17)23-10-12-24(13-11-23)19(26)20-18-6-4-14-27-18/h4,6-8,14-15H,2-3,5,9-13H2,1H3,(H,20,26) |
| InChIKey | CVSPDLVIFLLBGT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |