C19H18F3N7O — CID 122345827
4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 122345827) has the molecular formula C19H18F3N7O and a molecular weight of 417.40 g/mol. Its IUPAC name is 4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 122345827 |
| Molecular Formula | C19H18F3N7O |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccn(-c2ccc(N3CCN(C(=O)Nc4ccc(F)c(F)c4F)CC3)nn2)n1 |
| InChI | InChI=1S/C19H18F3N7O/c1-12-6-7-29(26-12)16-5-4-15(24-25-16)27-8-10-28(11-9-27)19(30)23-14-3-2-13(20)17(21)18(14)22/h2-7H,8-11H2,1H3,(H,23,30) |
| InChIKey | RRRKZQAOXZEPOS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|