C13H15F3N2O — CID 47193814
N-(2,3,4-trifluorophenyl)azepane-1-carboxamide (PubChem CID 47193814) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)azepane-1-carboxamide.
| Compound Name | N-(2,3,4-trifluorophenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 47193814 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)azepane-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)N1CCCCCC1 |
| InChI | InChI=1S/C13H15F3N2O/c14-9-5-6-10(12(16)11(9)15)17-13(19)18-7-3-1-2-4-8-18/h5-6H,1-4,7-8H2,(H,17,19) |
| InChIKey | VMWYOSSOMLBIGI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|