C16H22F3N3O2 — CID 111446778
4-[3-hydroxypropyl(methyl)amino]-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide (PubChem CID 111446778) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 4-[3-hydroxypropyl(methyl)amino]-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-[3-hydroxypropyl(methyl)amino]-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 111446778 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-[3-hydroxypropyl(methyl)amino]-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
| SMILES | CN(CCCO)C1CCN(C(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-21(7-2-10-23)11-5-8-22(9-6-11)16(24)20-13-4-3-12(17)14(18)15(13)19/h3-4,11,23H,2,5-10H2,1H3,(H,20,24) |
| InChIKey | WNWUIZJYRUCTRH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|