C15H24N4O2 — CID 71931015
4-[3-hydroxypropyl(methyl)amino]-N-pyridin-2-ylpiperidine-1-carboxamide (PubChem CID 71931015) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[3-hydroxypropyl(methyl)amino]-N-pyridin-2-ylpiperidine-1-carboxamide.
| Compound Name | 4-[3-hydroxypropyl(methyl)amino]-N-pyridin-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 71931015 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 4-[3-hydroxypropyl(methyl)amino]-N-pyridin-2-ylpiperidine-1-carboxamide |
| SMILES | CN(CCCO)C1CCN(C(=O)Nc2ccccn2)CC1 |
| InChI | InChI=1S/C15H24N4O2/c1-18(9-4-12-20)13-6-10-19(11-7-13)15(21)17-14-5-2-3-8-16-14/h2-3,5,8,13,20H,4,6-7,9-12H2,1H3,(H,16,17,21) |
| InChIKey | SOCDFNCYSCVOGX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |