C16H29N5O2 — CID 111383894
4-[3-hydroxypropyl(methyl)amino]-N-(2-propan-2-ylpyrazol-3-yl)piperidine-1-carboxamide (PubChem CID 111383894) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-[3-hydroxypropyl(methyl)amino]-N-(2-propan-2-ylpyrazol-3-yl)piperidine-1-carboxamide.
| Compound Name | 4-[3-hydroxypropyl(methyl)amino]-N-(2-propan-2-ylpyrazol-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 111383894 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 4-[3-hydroxypropyl(methyl)amino]-N-(2-propan-2-ylpyrazol-3-yl)piperidine-1-carboxamide |
| SMILES | CC(C)n1nccc1NC(=O)N1CCC(N(C)CCCO)CC1 |
| InChI | InChI=1S/C16H29N5O2/c1-13(2)21-15(5-8-17-21)18-16(23)20-10-6-14(7-11-20)19(3)9-4-12-22/h5,8,13-14,22H,4,6-7,9-12H2,1-3H3,(H,18,23) |
| InChIKey | HXCCGTWNCGTTGX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |