C18H25N7O — CID 129343516
(4R)-4-[(4-aminopyrimidin-2-yl)methyl-methylamino]-N-pyridin-2-ylazepane-1-carboxamide (PubChem CID 129343516) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is (4R)-4-[(4-aminopyrimidin-2-yl)methyl-methylamino]-N-pyridin-2-ylazepane-1-carboxamide.
| Compound Name | (4R)-4-[(4-aminopyrimidin-2-yl)methyl-methylamino]-N-pyridin-2-ylazepane-1-carboxamide |
|---|---|
| PubChem CID | 129343516 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4R)-4-[(4-aminopyrimidin-2-yl)methyl-methylamino]-N-pyridin-2-ylazepane-1-carboxamide |
| SMILES | CN(Cc1nccc(N)n1)[C@@H]1CCCN(C(=O)Nc2ccccn2)CC1 |
| InChI | InChI=1S/C18H25N7O/c1-24(13-17-21-10-7-15(19)22-17)14-5-4-11-25(12-8-14)18(26)23-16-6-2-3-9-20-16/h2-3,6-7,9-10,14H,4-5,8,11-13H2,1H3,(H2,19,21,22)(H,20,23,26)/t14-/m1/s1 |
| InChIKey | WWZBMWNGYOZNFK-CQSZACIVSA-N |
| XLogP | 1.97 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |