C17H20F3N3O3 — CID 5198504
4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide (PubChem CID 5198504) has the molecular formula C17H20F3N3O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is 4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 5198504 |
| Molecular Formula | C17H20F3N3O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-(5-ethyl-2-oxo-1,3-oxazolidin-3-yl)-N-(2,3,4-trifluorophenyl)piperidine-1-carboxamide |
| SMILES | CCC1CN(C2CCN(C(=O)Nc3ccc(F)c(F)c3F)CC2)C(=O)O1 |
| InChI | InChI=1S/C17H20F3N3O3/c1-2-11-9-23(17(25)26-11)10-5-7-22(8-6-10)16(24)21-13-4-3-12(18)14(19)15(13)20/h3-4,10-11H,2,5-9H2,1H3,(H,21,24) |
| InChIKey | VMIUELANJJJPKR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|