C15H18F3N3O3S — CID 113109677
4-(1,1-dioxothiolan-3-yl)-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 113109677) has the molecular formula C15H18F3N3O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109677 |
| Molecular Formula | C15H18F3N3O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H18F3N3O3S/c16-11-1-2-12(14(18)13(11)17)19-15(22)21-6-4-20(5-7-21)10-3-8-25(23,24)9-10/h1-2,10H,3-9H2,(H,19,22) |
| InChIKey | FZHONSHQNTUMFV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|