C17H23N3O4S — CID 113109653
N-(4-acetylphenyl)-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide (PubChem CID 113109653) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109653 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(4-acetylphenyl)-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)N2CCN(C3CCS(=O)(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O4S/c1-13(21)14-2-4-15(5-3-14)18-17(22)20-9-7-19(8-10-20)16-6-11-25(23,24)12-16/h2-5,16H,6-12H2,1H3,(H,18,22) |
| InChIKey | UQUAYECXQFWQES-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |