C19H23N3O3S — CID 24616441
4-(1,1-dioxothiolan-3-yl)-N-naphthalen-1-ylpiperazine-1-carboxamide (PubChem CID 24616441) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)-N-naphthalen-1-ylpiperazine-1-carboxamide.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)-N-naphthalen-1-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 24616441 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)-N-naphthalen-1-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C19H23N3O3S/c23-19(20-18-7-3-5-15-4-1-2-6-17(15)18)22-11-9-21(10-12-22)16-8-13-26(24,25)14-16/h1-7,16H,8-14H2,(H,20,23) |
| InChIKey | JRSZUFJTNJGBNP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |