C15H16N2O3 — CID 79411310
(3S,4R)-3,4-dihydroxy-N-naphthalen-1-ylpyrrolidine-1-carboxamide (PubChem CID 79411310) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3S,4R)-3,4-dihydroxy-N-naphthalen-1-ylpyrrolidine-1-carboxamide.
| Compound Name | (3S,4R)-3,4-dihydroxy-N-naphthalen-1-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 79411310 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3S,4R)-3,4-dihydroxy-N-naphthalen-1-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C15H16N2O3/c18-13-8-17(9-14(13)19)15(20)16-12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13-14,18-19H,8-9H2,(H,16,20)/t13-,14+ |
| InChIKey | HCJIWAOUSLOGCB-OKILXGFUSA-N |
| XLogP | 1.41 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |