C11H13FN2O3 — CID 79410579
(3R,4S)-N-(2-fluorophenyl)-3,4-dihydroxypyrrolidine-1-carboxamide (PubChem CID 79410579) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is (3R,4S)-N-(2-fluorophenyl)-3,4-dihydroxypyrrolidine-1-carboxamide.
| Compound Name | (3R,4S)-N-(2-fluorophenyl)-3,4-dihydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 79410579 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (3R,4S)-N-(2-fluorophenyl)-3,4-dihydroxypyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1F)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H13FN2O3/c12-7-3-1-2-4-8(7)13-11(17)14-5-9(15)10(16)6-14/h1-4,9-10,15-16H,5-6H2,(H,13,17)/t9-,10+ |
| InChIKey | FPJPHZAJBALYAY-AOOOYVTPSA-N |
| XLogP | 0.40 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |