C18H25N3O5S — CID 113109673
ethyl 2-[[4-(1,1-dioxothiolan-3-yl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 113109673) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is ethyl 2-[[4-(1,1-dioxothiolan-3-yl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[4-(1,1-dioxothiolan-3-yl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113109673 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 2-[[4-(1,1-dioxothiolan-3-yl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C18H25N3O5S/c1-2-26-17(22)15-5-3-4-6-16(15)19-18(23)21-10-8-20(9-11-21)14-7-12-27(24,25)13-14/h3-6,14H,2,7-13H2,1H3,(H,19,23) |
| InChIKey | LDJBXBBWFBDYGJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |