C16H23N3O3S — CID 24664554
N-benzyl-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide (PubChem CID 24664554) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is N-benzyl-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 24664554 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-benzyl-4-(1,1-dioxothiolan-3-yl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c20-16(17-12-14-4-2-1-3-5-14)19-9-7-18(8-10-19)15-6-11-23(21,22)13-15/h1-5,15H,6-13H2,(H,17,20) |
| InChIKey | GTAYWBPXFKRJGL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |