C17H25N3O2S2 — CID 9284168
4-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)piperazine-1-carbothioamide (PubChem CID 9284168) has the molecular formula C17H25N3O2S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is 4-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)piperazine-1-carbothioamide.
| Compound Name | 4-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9284168 |
| Molecular Formula | C17H25N3O2S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-[(3S)-1,1-dioxothiolan-3-yl]-N-(2-phenylethyl)piperazine-1-carbothioamide |
| SMILES | O=S1(=O)CC[C@H](N2CCN(C(=S)NCCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C17H25N3O2S2/c21-24(22)13-7-16(14-24)19-9-11-20(12-10-19)17(23)18-8-6-15-4-2-1-3-5-15/h1-5,16H,6-14H2,(H,18,23)/t16-/m0/s1 |
| InChIKey | RXCGSVQMXGLDEY-INIZCTEOSA-N |
| XLogP | 0.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|