C17H25N3O2S2 — CID 8600282
N-(2,5-dimethylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioamide (PubChem CID 8600282) has the molecular formula C17H25N3O2S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8600282 |
| Molecular Formula | C17H25N3O2S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(C)c(NC(=S)N2CCN([C@@H]3CCS(=O)(=O)C3)CC2)c1 |
| InChI | InChI=1S/C17H25N3O2S2/c1-13-3-4-14(2)16(11-13)18-17(23)20-8-6-19(7-9-20)15-5-10-24(21,22)12-15/h3-4,11,15H,5-10,12H2,1-2H3,(H,18,23)/t15-/m1/s1 |
| InChIKey | GITAXHGEEFSTLB-OAHLLOKOSA-N |
| XLogP | 1.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|