C14H25N3O4S2 — CID 9284238
methyl 4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioyl]amino]butanoate (PubChem CID 9284238) has the molecular formula C14H25N3O4S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is methyl 4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioyl]amino]butanoate.
| Compound Name | methyl 4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioyl]amino]butanoate |
|---|---|
| PubChem CID | 9284238 |
| Molecular Formula | C14H25N3O4S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | methyl 4-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazine-1-carbothioyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=S)N1CCN([C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C14H25N3O4S2/c1-21-13(18)3-2-5-15-14(22)17-8-6-16(7-9-17)12-4-10-23(19,20)11-12/h12H,2-11H2,1H3,(H,15,22)/t12-/m1/s1 |
| InChIKey | UJVGJEHLWIMSRU-GFCCVEGCSA-N |
| XLogP | -0.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|