C14H21N5O2S — CID 9053685
methyl 4-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]butanoate (PubChem CID 9053685) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is methyl 4-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]butanoate.
| Compound Name | methyl 4-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]butanoate |
|---|---|
| PubChem CID | 9053685 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | methyl 4-[(4-pyrimidin-2-ylpiperazine-1-carbothioyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=S)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H21N5O2S/c1-21-12(20)4-2-5-17-14(22)19-10-8-18(9-11-19)13-15-6-3-7-16-13/h3,6-7H,2,4-5,8-11H2,1H3,(H,17,22) |
| InChIKey | NOCSQZZUDBIKHS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|