C13H20BrN5OS — CID 43076098
4-(5-bromopyrimidin-2-yl)-N-(3-methoxypropyl)piperazine-1-carbothioamide (PubChem CID 43076098) has the molecular formula C13H20BrN5OS and a molecular weight of 374.31 g/mol. Its IUPAC name is 4-(5-bromopyrimidin-2-yl)-N-(3-methoxypropyl)piperazine-1-carbothioamide.
| Compound Name | 4-(5-bromopyrimidin-2-yl)-N-(3-methoxypropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 43076098 |
| Molecular Formula | C13H20BrN5OS |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-(5-bromopyrimidin-2-yl)-N-(3-methoxypropyl)piperazine-1-carbothioamide |
| SMILES | COCCCNC(=S)N1CCN(c2ncc(Br)cn2)CC1 |
| InChI | InChI=1S/C13H20BrN5OS/c1-20-8-2-3-15-13(21)19-6-4-18(5-7-19)12-16-9-11(14)10-17-12/h9-10H,2-8H2,1H3,(H,15,21) |
| InChIKey | HKKQZYCUAOSADL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|