C18H29N5O3S — CID 96557686
4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]butan-1-one (PubChem CID 96557686) has the molecular formula C18H29N5O3S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 96557686 |
| Molecular Formula | C18H29N5O3S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)amino]-1-[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1cc(C)nc(NCCCC(=O)N2CCN([C@H]3CCS(=O)(=O)C3)CC2)n1 |
| InChI | InChI=1S/C18H29N5O3S/c1-14-12-15(2)21-18(20-14)19-6-3-4-17(24)23-9-7-22(8-10-23)16-5-11-27(25,26)13-16/h12,16H,3-11,13H2,1-2H3,(H,19,20,21)/t16-/m0/s1 |
| InChIKey | IPENKKCYRTVAOV-INIZCTEOSA-N |
| XLogP | 0.62 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|