C11H21N3O2S — CID 66203857
3-[4-(azetidin-3-yl)piperazin-1-yl]thiolane 1,1-dioxide (PubChem CID 66203857) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is 3-[4-(azetidin-3-yl)piperazin-1-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[4-(azetidin-3-yl)piperazin-1-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66203857 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[4-(azetidin-3-yl)piperazin-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CCN(C3CNC3)CC2)C1 |
| InChI | InChI=1S/C11H21N3O2S/c15-17(16)6-1-10(9-17)13-2-4-14(5-3-13)11-7-12-8-11/h10-12H,1-9H2 |
| InChIKey | TWFUDIFZLYMLQB-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |