C13H25N3O2S — CID 80552789
1-[1-(1,1-dioxothiolan-3-yl)pyrrolidin-3-yl]piperidin-4-amine (PubChem CID 80552789) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-[1-(1,1-dioxothiolan-3-yl)pyrrolidin-3-yl]piperidin-4-amine.
| Compound Name | 1-[1-(1,1-dioxothiolan-3-yl)pyrrolidin-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 80552789 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-[1-(1,1-dioxothiolan-3-yl)pyrrolidin-3-yl]piperidin-4-amine |
| SMILES | NC1CCN(C2CCN(C3CCS(=O)(=O)C3)C2)CC1 |
| InChI | InChI=1S/C13H25N3O2S/c14-11-1-5-15(6-2-11)12-3-7-16(9-12)13-4-8-19(17,18)10-13/h11-13H,1-10,14H2 |
| InChIKey | DBALVEKHSKGMLH-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |