C9H17NO3S — CID 107226058
(3S)-1-(1,1-dioxothiolan-3-yl)piperidin-3-ol (PubChem CID 107226058) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is (3S)-1-(1,1-dioxothiolan-3-yl)piperidin-3-ol.
| Compound Name | (3S)-1-(1,1-dioxothiolan-3-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 107226058 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (3S)-1-(1,1-dioxothiolan-3-yl)piperidin-3-ol |
| SMILES | O=S1(=O)CCC(N2CCC[C@H](O)C2)C1 |
| InChI | InChI=1S/C9H17NO3S/c11-9-2-1-4-10(6-9)8-3-5-14(12,13)7-8/h8-9,11H,1-7H2/t8?,9-/m0/s1 |
| InChIKey | XLIKMZVQLFYOKT-GKAPJAKFSA-N |
| XLogP | -0.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |