C9H18N2O2S — CID 39225830
(3S)-1-[(3R)-1,1-dioxothiolan-3-yl]piperidin-3-amine (PubChem CID 39225830) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is (3S)-1-[(3R)-1,1-dioxothiolan-3-yl]piperidin-3-amine.
| Compound Name | (3S)-1-[(3R)-1,1-dioxothiolan-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 39225830 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (3S)-1-[(3R)-1,1-dioxothiolan-3-yl]piperidin-3-amine |
| SMILES | N[C@H]1CCCN([C@@H]2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C9H18N2O2S/c10-8-2-1-4-11(6-8)9-3-5-14(12,13)7-9/h8-9H,1-7,10H2/t8-,9+/m0/s1 |
| InChIKey | ULMFNSUIXVUPDM-DTWKUNHWSA-N |
| XLogP | -0.40 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |