C8H15NO3S — CID 7072045
(3R)-3-morpholin-4-ylthiolane 1,1-dioxide (PubChem CID 7072045) has the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. Its IUPAC name is (3R)-3-morpholin-4-ylthiolane 1,1-dioxide.
| Compound Name | (3R)-3-morpholin-4-ylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 7072045 |
| Molecular Formula | C8H15NO3S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | (3R)-3-morpholin-4-ylthiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C8H15NO3S/c10-13(11)6-1-8(7-13)9-2-4-12-5-3-9/h8H,1-7H2/t8-/m1/s1 |
| InChIKey | WPFHERFZMTXDJX-MRVPVSSYSA-N |
| XLogP | -0.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |