About 4-cyclopropylmorpholine;ethane
4-cyclopropylmorpholine;ethane (PubChem CID 155594914) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 4-cyclopropylmorpholine;ethane.
Molecular Properties
| Compound Name | 4-cyclopropylmorpholine;ethane |
| PubChem CID | 155594914 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 4-cyclopropylmorpholine;ethane |
| SMILES | C1CN(C2CC2)CCO1.CC |
| InChI | InChI=1S/C7H13NO.C2H6/c1-2-7(1)8-3-5-9-6-4-8;1-2/h7H,1-6H2;1-2H3 |
| InChIKey | MNJVKYLOYKTCCG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopropylmorpholine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropylmorpholine;ethane?
The IUPAC name of 4-cyclopropylmorpholine;ethane (CID 155594914) is 4-cyclopropylmorpholine;ethane.
What is the SMILES notation for 4-cyclopropylmorpholine;ethane?
The canonical SMILES for 4-cyclopropylmorpholine;ethane is C1CN(C2CC2)CCO1.CC.
What is the InChIKey of 4-cyclopropylmorpholine;ethane?
The InChIKey is MNJVKYLOYKTCCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C2H6/c1-2-7(1)8-3-5-9-6-4-8;1-2/h7H,1-6H2;1-2H3.
What are the key properties of 4-cyclopropylmorpholine;ethane?
4-cyclopropylmorpholine;ethane has a molecular weight of 157.26 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropylmorpholine;ethane is sourced from PubChem (CID 155594914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).