C12H23NO — CID 143263488
4-[(1S,4S)-4-methylcycloheptyl]morpholine (PubChem CID 143263488) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4-[(1S,4S)-4-methylcycloheptyl]morpholine.
| Compound Name | 4-[(1S,4S)-4-methylcycloheptyl]morpholine |
|---|---|
| PubChem CID | 143263488 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4-[(1S,4S)-4-methylcycloheptyl]morpholine |
| SMILES | C[C@H]1CCC[C@H](N2CCOCC2)CC1 |
| InChI | InChI=1S/C12H23NO/c1-11-3-2-4-12(6-5-11)13-7-9-14-10-8-13/h11-12H,2-10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | PAIRWWPBBPSVKF-RYUDHWBXSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |