C15H27NO2 — CID 65082997
4-methyl-1-(4-methylcycloheptyl)piperidine-4-carboxylic acid (PubChem CID 65082997) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-methyl-1-(4-methylcycloheptyl)piperidine-4-carboxylic acid.
| Compound Name | 4-methyl-1-(4-methylcycloheptyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 65082997 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 4-methyl-1-(4-methylcycloheptyl)piperidine-4-carboxylic acid |
| SMILES | CC1CCCC(N2CCC(C)(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C15H27NO2/c1-12-4-3-5-13(7-6-12)16-10-8-15(2,9-11-16)14(17)18/h12-13H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | DTIDEMHESANHGX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |