C12H21F2N — CID 58395271
4,4-difluoro-1-(4-methylcyclohexyl)piperidine (PubChem CID 58395271) has the molecular formula C12H21F2N and a molecular weight of 217.30 g/mol. Its IUPAC name is 4,4-difluoro-1-(4-methylcyclohexyl)piperidine.
| Compound Name | 4,4-difluoro-1-(4-methylcyclohexyl)piperidine |
|---|---|
| PubChem CID | 58395271 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4,4-difluoro-1-(4-methylcyclohexyl)piperidine |
| SMILES | CC1CCC(N2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C12H21F2N/c1-10-2-4-11(5-3-10)15-8-6-12(13,14)7-9-15/h10-11H,2-9H2,1H3 |
| InChIKey | IJPCIQJOAHXWLR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |