C13H23F2N — CID 126539817
1-(4,4-difluorocyclohexyl)-4,4-dimethylpiperidine (PubChem CID 126539817) has the molecular formula C13H23F2N and a molecular weight of 231.33 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-4,4-dimethylpiperidine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-4,4-dimethylpiperidine |
|---|---|
| PubChem CID | 126539817 |
| Molecular Formula | C13H23F2N |
| Molecular Weight | 231.33 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-4,4-dimethylpiperidine |
| SMILES | CC1(C)CCN(C2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C13H23F2N/c1-12(2)7-9-16(10-8-12)11-3-5-13(14,15)6-4-11/h11H,3-10H2,1-2H3 |
| InChIKey | MHZFZRFDKRHZIN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |