C9H15F2N — CID 91599149
1-cyclobutyl-4,4-difluoropiperidine (PubChem CID 91599149) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is 1-cyclobutyl-4,4-difluoropiperidine.
| Compound Name | 1-cyclobutyl-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 91599149 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-cyclobutyl-4,4-difluoropiperidine |
| SMILES | FC1(F)CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C9H15F2N/c10-9(11)4-6-12(7-5-9)8-2-1-3-8/h8H,1-7H2 |
| InChIKey | VXPFJNHXARQEFY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |