About 1-cyclobutyl-4,4-difluoropiperidine
1-cyclobutyl-4,4-difluoropiperidine (PubChem CID 91599149) has the molecular formula C9H15F2N
and a molecular weight of 175.22 g/mol. Its IUPAC name is 1-cyclobutyl-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-cyclobutyl-4,4-difluoropiperidine |
| PubChem CID | 91599149 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-cyclobutyl-4,4-difluoropiperidine |
| SMILES | FC1(F)CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C9H15F2N/c10-9(11)4-6-12(7-5-9)8-2-1-3-8/h8H,1-7H2 |
| InChIKey | VXPFJNHXARQEFY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclobutyl-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-4,4-difluoropiperidine?
The IUPAC name of 1-cyclobutyl-4,4-difluoropiperidine (CID 91599149) is 1-cyclobutyl-4,4-difluoropiperidine.
What is the SMILES notation for 1-cyclobutyl-4,4-difluoropiperidine?
The canonical SMILES for 1-cyclobutyl-4,4-difluoropiperidine is FC1(F)CCN(C2CCC2)CC1.
What is the InChIKey of 1-cyclobutyl-4,4-difluoropiperidine?
The InChIKey is VXPFJNHXARQEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2N/c10-9(11)4-6-12(7-5-9)8-2-1-3-8/h8H,1-7H2.
What are the key properties of 1-cyclobutyl-4,4-difluoropiperidine?
1-cyclobutyl-4,4-difluoropiperidine has a molecular weight of 175.22 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-4,4-difluoropiperidine is sourced from PubChem (CID 91599149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).