C8H13F2NO — CID 145419843
4,4-difluoro-1-(oxetan-3-yl)piperidine (PubChem CID 145419843) has the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. Its IUPAC name is 4,4-difluoro-1-(oxetan-3-yl)piperidine.
| Compound Name | 4,4-difluoro-1-(oxetan-3-yl)piperidine |
|---|---|
| PubChem CID | 145419843 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4,4-difluoro-1-(oxetan-3-yl)piperidine |
| SMILES | FC1(F)CCN(C2COC2)CC1 |
| InChI | InChI=1S/C8H13F2NO/c9-8(10)1-3-11(4-2-8)7-5-12-6-7/h7H,1-6H2 |
| InChIKey | KGXRXZLVZOEPSB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |